CAS 109716-61-2 appears in our catalog under these names: Ethyl (1S,2S)-2-formylcyclopropane-1-carboxylate, 98%, Cyclopropanecarboxylic acid, 2-formyl-, ethyl ester, (1S-trans)- (9CI), ≥95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g.
Cis-ethyl (1S,2S)-2-formylcyclopropane-1-carboxylate (CAS 109716-61-2) is a chemical compound with the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. IUPAC name: cis-ethyl (1S,2S)-2-formylcyclopropane-1-carboxylate. InChIKey: MDWXTLNIZCHBJE-RITPCOANSA-N.
| Molecular formula | C7H10O3 |
|---|---|
| Molecular weight | 142.15 g/mol |
| IUPAC name | cis-ethyl (1S,2S)-2-formylcyclopropane-1-carboxylate |
| InChIKey | MDWXTLNIZCHBJE-RITPCOANSA-N |
| SMILES | CCOC(=O)[C@H]1C[C@@H]1C=O |
Computed by PubChem (NCBI)