CAS 1097536-13-4 is the registry number for N-(4-Bromobenzoyl)-N-isopropylglycine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Propan-2-yl 2-[(4-bromobenzoyl)amino]acetate (CAS 1097536-13-4) is a chemical compound with the molecular formula C12H14BrNO3 and a molecular weight of 300.15 g/mol. IUPAC name: propan-2-yl 2-[(4-bromobenzoyl)amino]acetate. InChIKey: LHIGVSDJSHGTAA-UHFFFAOYSA-N.
| Molecular formula | C12H14BrNO3 |
|---|---|
| Molecular weight | 300.15 g/mol |
| IUPAC name | propan-2-yl 2-[(4-bromobenzoyl)amino]acetate |
| InChIKey | LHIGVSDJSHGTAA-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)CNC(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)