Products 1097679-78-1
CAS 1097679-78-1 is the registry number for Dykellic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[5-methylidene-2-oxo-6-[(1E,3E)-penta-1,3-dienyl]pyran-3-yl]propanoic acid (CAS 1097679-78-1) is a chemical compound with the molecular formula C14H16O4 and a molecular weight of 248.27 g/mol. IUPAC name: 3-[5-methylidene-2-oxo-6-[(1E,3E)-penta-1,3-dienyl]pyran-3-yl]propanoic acid. InChIKey: XMBYWWHLSMXSPA-VNKDHWASSA-N.
| Molecular formula | C14H16O4 |
|---|---|
| Molecular weight | 248.27 g/mol |
| IUPAC name | 3-[5-methylidene-2-oxo-6-[(1E,3E)-penta-1,3-dienyl]pyran-3-yl]propanoic acid |
| InChIKey | XMBYWWHLSMXSPA-VNKDHWASSA-N |
| SMILES | C/C=C/C=C/C1C(=C)C=C(C(=O)O1)CCC(=O)O |
Computed by PubChem (NCBI)