Products 1097788-54-9
CAS 1097788-54-9 appears in our catalog under these names: 5-Methylimidazo[1,2-a]pyridine-2-carbohydrazide, 98%, 5-methylimidazo[1,2-a]pyridine-2-carbohydrazide. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g.
5-methylimidazo[1,2-a]pyridine-2-carbohydrazide (CAS 1097788-54-9) is a chemical compound with the molecular formula C9H10N4O and a molecular weight of 190.20 g/mol. IUPAC name: 5-methylimidazo[1,2-a]pyridine-2-carbohydrazide. InChIKey: YZHUOSZIGGMOJL-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 5-methylimidazo[1,2-a]pyridine-2-carbohydrazide |
| InChIKey | YZHUOSZIGGMOJL-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC2=NC(=CN12)C(=O)NN |
Computed by PubChem (NCBI)