CAS 1097802-78-2 is the registry number for 6,7-Difluoro-3,4-dihydro-2H-1-benzothiopyran-4-one, 95%. Offered by: AmBeed. Available pack sizes: 5g.
6,7-difluoro-2,3-dihydrothiochromen-4-one (CAS 1097802-78-2) is a chemical compound with the molecular formula C9H6F2OS and a molecular weight of 200.21 g/mol. IUPAC name: 6,7-difluoro-2,3-dihydrothiochromen-4-one. InChIKey: ZKHRMJIMQAGHPD-UHFFFAOYSA-N.
| Molecular formula | C9H6F2OS |
|---|---|
| Molecular weight | 200.21 g/mol |
| IUPAC name | 6,7-difluoro-2,3-dihydrothiochromen-4-one |
| InChIKey | ZKHRMJIMQAGHPD-UHFFFAOYSA-N |
| SMILES | C1CSC2=CC(=C(C=C2C1=O)F)F |
Computed by PubChem (NCBI)