CAS 1400702-19-3 is the registry number for (5,7-Difluorobenzo(b)thiophen-2-yl)methanol, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
(5,7-difluoro-1-benzothiophen-2-yl)methanol (CAS 1400702-19-3) is a chemical compound with the molecular formula C9H6F2OS and a molecular weight of 200.21 g/mol. IUPAC name: (5,7-difluoro-1-benzothiophen-2-yl)methanol. InChIKey: XTSSRKVRAGMBEJ-UHFFFAOYSA-N.
| Molecular formula | C9H6F2OS |
|---|---|
| Molecular weight | 200.21 g/mol |
| IUPAC name | (5,7-difluoro-1-benzothiophen-2-yl)methanol |
| InChIKey | XTSSRKVRAGMBEJ-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(SC2=C(C=C1F)F)CO |
Computed by PubChem (NCBI)