CAS 1153968-35-4 appears in our catalog under these names: 5,8-Difluoro-3,4-dihydro-2H-1-benzothiopyran-4-one, 95%, 5,8-Difluoro-3,4-dihydro-2H-1-benzothiopyran-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
5,8-difluoro-2,3-dihydrothiochromen-4-one (CAS 1153968-35-4) is a chemical compound with the molecular formula C9H6F2OS and a molecular weight of 200.21 g/mol. IUPAC name: 5,8-difluoro-2,3-dihydrothiochromen-4-one. InChIKey: REMASFXZMHTLPE-UHFFFAOYSA-N.
| Molecular formula | C9H6F2OS |
|---|---|
| Molecular weight | 200.21 g/mol |
| IUPAC name | 5,8-difluoro-2,3-dihydrothiochromen-4-one |
| InChIKey | REMASFXZMHTLPE-UHFFFAOYSA-N |
| SMILES | C1CSC2=C(C=CC(=C2C1=O)F)F |
Computed by PubChem (NCBI)