Products 1097826-42-0
CAS 1097826-42-0 is the registry number for 1–(3–Bromophenyl)cyclopentanamine. Offered by: GLPBio. Available pack sizes: 100mg.
1-(3-bromophenyl)cyclopentan-1-amine (CAS 1097826-42-0) is a chemical compound with the molecular formula C11H14BrN and a molecular weight of 240.14 g/mol. IUPAC name: 1-(3-bromophenyl)cyclopentan-1-amine. InChIKey: LOLPDEFCBXDDEC-UHFFFAOYSA-N.
| Molecular formula | C11H14BrN |
|---|---|
| Molecular weight | 240.14 g/mol |
| IUPAC name | 1-(3-bromophenyl)cyclopentan-1-amine |
| InChIKey | LOLPDEFCBXDDEC-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC(=CC=C2)Br)N |
Computed by PubChem (NCBI)