CAS 1341034-57-8 appears in our catalog under these names: 6-Bromo-2-ethyl-1,2,3,4-tetrahydro-isoquinoline, 95%, 6-Bromo-2-ethyl-1,2,3,4-tetrahydroisoquinoline, 95+%, 6–Bromo–2–ethyl–1,2,3,4–tetrahydroisoquinoline. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 100mg, 250mg, 1g, 5g.
6-bromo-2-ethyl-3,4-dihydro-1H-isoquinoline (CAS 1341034-57-8) is a chemical compound with the molecular formula C11H14BrN and a molecular weight of 240.14 g/mol. IUPAC name: 6-bromo-2-ethyl-3,4-dihydro-1H-isoquinoline. InChIKey: YZGICEWDTPWCAC-UHFFFAOYSA-N.
| Molecular formula | C11H14BrN |
|---|---|
| Molecular weight | 240.14 g/mol |
| IUPAC name | 6-bromo-2-ethyl-3,4-dihydro-1H-isoquinoline |
| InChIKey | YZGICEWDTPWCAC-UHFFFAOYSA-N |
| SMILES | CCN1CCC2=C(C1)C=CC(=C2)Br |
Computed by PubChem (NCBI)