CAS 1097826-86-2 is the registry number for 3-Amino-4-chloro-N-(2-hydroxyethyl)benzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-amino-4-chloro-N-(2-hydroxyethyl)benzamide (CAS 1097826-86-2) is a chemical compound with the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. IUPAC name: 3-amino-4-chloro-N-(2-hydroxyethyl)benzamide. InChIKey: DPMZPUIFRULOKH-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O2 |
|---|---|
| Molecular weight | 214.65 g/mol |
| IUPAC name | 3-amino-4-chloro-N-(2-hydroxyethyl)benzamide |
| InChIKey | DPMZPUIFRULOKH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)NCCO)N)Cl |
Computed by PubChem (NCBI)