Products 1097876-24-8
CAS 1097876-24-8 is the registry number for 3-Cyclopropyl-6-iodo-[1,2,4]triazolo[4,3-b]pyridazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-cyclopropyl-6-iodo-[1,2,4]triazolo[4,3-b]pyridazine (CAS 1097876-24-8) is a chemical compound with the molecular formula C8H7IN4 and a molecular weight of 286.07 g/mol. IUPAC name: 3-cyclopropyl-6-iodo-[1,2,4]triazolo[4,3-b]pyridazine. InChIKey: UJMNZIVFOPRNDF-UHFFFAOYSA-N.
| Molecular formula | C8H7IN4 |
|---|---|
| Molecular weight | 286.07 g/mol |
| IUPAC name | 3-cyclopropyl-6-iodo-[1,2,4]triazolo[4,3-b]pyridazine |
| InChIKey | UJMNZIVFOPRNDF-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NN=C3N2N=C(C=C3)I |
Computed by PubChem (NCBI)