CAS 119584-76-8 is the registry number for 5-Iodoquinazoline-2,4-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
5-iodoquinazoline-2,4-diamine (CAS 119584-76-8) is a chemical compound with the molecular formula C8H7IN4 and a molecular weight of 286.07 g/mol. IUPAC name: 5-iodoquinazoline-2,4-diamine. InChIKey: SUZLYYOTNUWNLR-UHFFFAOYSA-N.
| Molecular formula | C8H7IN4 |
|---|---|
| Molecular weight | 286.07 g/mol |
| IUPAC name | 5-iodoquinazoline-2,4-diamine |
| InChIKey | SUZLYYOTNUWNLR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)I)C(=NC(=N2)N)N |
Computed by PubChem (NCBI)