CAS 313662-93-0 is the registry number for 5-(2-Iodophenyl)-4H-1,2,4-triazol-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2-iodophenyl)-1H-1,2,4-triazol-3-amine (CAS 313662-93-0) is a chemical compound with the molecular formula C8H7IN4 and a molecular weight of 286.07 g/mol. IUPAC name: 5-(2-iodophenyl)-1H-1,2,4-triazol-3-amine. InChIKey: GZHPAQZSCZABHN-UHFFFAOYSA-N.
| Molecular formula | C8H7IN4 |
|---|---|
| Molecular weight | 286.07 g/mol |
| IUPAC name | 5-(2-iodophenyl)-1H-1,2,4-triazol-3-amine |
| InChIKey | GZHPAQZSCZABHN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC(=NN2)N)I |
Computed by PubChem (NCBI)