Products 109803-48-7
CAS 109803-48-7 is the registry number for Methyl 5-chloro-4-methoxy-2-methylbenzoate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
Methyl 5-chloro-4-methoxy-2-methylbenzoate (CAS 109803-48-7) is a chemical compound with the molecular formula C10H11ClO3 and a molecular weight of 214.64 g/mol. IUPAC name: methyl 5-chloro-4-methoxy-2-methylbenzoate. InChIKey: YPPCIMDEHVUNPU-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO3 |
|---|---|
| Molecular weight | 214.64 g/mol |
| IUPAC name | methyl 5-chloro-4-methoxy-2-methylbenzoate |
| InChIKey | YPPCIMDEHVUNPU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C(=O)OC)Cl)OC |
Computed by PubChem (NCBI)