CAS 109807-20-7 is the registry number for Ethyl 5-([1,1'-biphenyl]-4-yl)isoxazole-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 5-(4-phenylphenyl)-1,2-oxazole-3-carboxylate (CAS 109807-20-7) is a chemical compound with the molecular formula C18H15NO3 and a molecular weight of 293.3 g/mol. IUPAC name: ethyl 5-(4-phenylphenyl)-1,2-oxazole-3-carboxylate. InChIKey: DRJUERDDRKPRNJ-UHFFFAOYSA-N.
| Molecular formula | C18H15NO3 |
|---|---|
| Molecular weight | 293.3 g/mol |
| IUPAC name | ethyl 5-(4-phenylphenyl)-1,2-oxazole-3-carboxylate |
| InChIKey | DRJUERDDRKPRNJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NOC(=C1)C2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)