CAS 1098106-78-5 appears in our catalog under these names: 3-(3-Bromophenyl)-2,2-dimethylpropan-1-amine hydrochloride, 95%, 3-(3-Bromophenyl)-2,2-dimethylpropan-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
3-(3-bromophenyl)-2,2-dimethylpropan-1-amine;hydrochloride (CAS 1098106-78-5) is a chemical compound with the molecular formula C11H17BrClN and a molecular weight of 278.61 g/mol. IUPAC name: 3-(3-bromophenyl)-2,2-dimethylpropan-1-amine;hydrochloride. InChIKey: KGCFNOFYBYMNAF-UHFFFAOYSA-N.
| Molecular formula | C11H17BrClN |
|---|---|
| Molecular weight | 278.61 g/mol |
| IUPAC name | 3-(3-bromophenyl)-2,2-dimethylpropan-1-amine;hydrochloride |
| InChIKey | KGCFNOFYBYMNAF-UHFFFAOYSA-N |
| SMILES | CC(C)(CC1=CC(=CC=C1)Br)CN.Cl |
Computed by PubChem (NCBI)