CAS 1098344-00-3 appears in our catalog under these names: 1-(3,4-Dichlorophenyl)-2-(3-fluorophenyl)ethan-1-one, 95%, 1-(3,4-Dichlorophenyl)-2-(3-fluorophenyl)ethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
1-(3,4-dichlorophenyl)-2-(3-fluorophenyl)ethanone (CAS 1098344-00-3) is a chemical compound with the molecular formula C14H9Cl2FO and a molecular weight of 283.1 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)-2-(3-fluorophenyl)ethanone. InChIKey: XRBJNIUNZTXPHJ-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl2FO |
|---|---|
| Molecular weight | 283.1 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)-2-(3-fluorophenyl)ethanone |
| InChIKey | XRBJNIUNZTXPHJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)CC(=O)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)