CAS 1403667-07-1 appears in our catalog under these names: 2,2-Dichloro-1-(4-fluorophenyl)-2-phenylethanone, 2,2–Dichloro–1–(4–fluorophenyl)–2–phenylethanone, Atorvastatin Impurity 28, 2,2-DICHLORO-1-(4-FLUOROPHENYL)-2-PHENYLETHANONE, 95%. Offered by: TRC, GLPBio, Biosynth, Chemat Brand, Fluorochem. Available pack sizes: 1g, 100mg, 25mg, 0,25g, on request, 250mg.
2,2-dichloro-1-(4-fluorophenyl)-2-phenylethanone (CAS 1403667-07-1) is a chemical compound with the molecular formula C14H9Cl2FO and a molecular weight of 283.1 g/mol. IUPAC name: 2,2-dichloro-1-(4-fluorophenyl)-2-phenylethanone. InChIKey: NHWFNDBTRRTXFW-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl2FO |
|---|---|
| Molecular weight | 283.1 g/mol |
| IUPAC name | 2,2-dichloro-1-(4-fluorophenyl)-2-phenylethanone |
| InChIKey | NHWFNDBTRRTXFW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)C2=CC=C(C=C2)F)(Cl)Cl |
Computed by PubChem (NCBI)