Products 611220-24-7
CAS 611220-24-7 is the registry number for 1-(2,4-Dichlorophenyl)-2-(4-fluorophenyl)ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-(2,4-dichlorophenyl)-2-(4-fluorophenyl)ethanone (CAS 611220-24-7) is a chemical compound with the molecular formula C14H9Cl2FO and a molecular weight of 283.1 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)-2-(4-fluorophenyl)ethanone. InChIKey: HYHDKMSFNXCASW-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl2FO |
|---|---|
| Molecular weight | 283.1 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)-2-(4-fluorophenyl)ethanone |
| InChIKey | HYHDKMSFNXCASW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)C2=C(C=C(C=C2)Cl)Cl)F |
Computed by PubChem (NCBI)