CAS 1098347-54-6 is the registry number for 2-Chloro-n-quinolin-3-ylpropanamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-chloro-N-quinolin-3-ylpropanamide (CAS 1098347-54-6) is a chemical compound with the molecular formula C12H11ClN2O and a molecular weight of 234.68 g/mol. IUPAC name: 2-chloro-N-quinolin-3-ylpropanamide. InChIKey: AOZIQRTWMQQNOF-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O |
|---|---|
| Molecular weight | 234.68 g/mol |
| IUPAC name | 2-chloro-N-quinolin-3-ylpropanamide |
| InChIKey | AOZIQRTWMQQNOF-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=CC2=CC=CC=C2N=C1)Cl |
Computed by PubChem (NCBI)