Products 1098347-63-7
CAS 1098347-63-7 appears in our catalog under these names: 3-(2-Chloropropanamido)-n,n-diethylbenzamide, 95%, 3-(2-Chloropropanamido)-N,N-diethylbenzamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
3-(2-chloropropanoylamino)-N,N-diethylbenzamide (CAS 1098347-63-7) is a chemical compound with the molecular formula C14H19ClN2O2 and a molecular weight of 282.76 g/mol. IUPAC name: 3-(2-chloropropanoylamino)-N,N-diethylbenzamide. InChIKey: QTGRSOUNUZEXMQ-UHFFFAOYSA-N.
| Molecular formula | C14H19ClN2O2 |
|---|---|
| Molecular weight | 282.76 g/mol |
| IUPAC name | 3-(2-chloropropanoylamino)-N,N-diethylbenzamide |
| InChIKey | QTGRSOUNUZEXMQ-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)C1=CC(=CC=C1)NC(=O)C(C)Cl |
Computed by PubChem (NCBI)