CAS 886364-27-8 appears in our catalog under these names: 4-Boc-8-chloro-2,3,4,5-tetrahydro-1h-benzo[e][1,4]diazepine, 95%, tert-Butyl 8-chloro-2,3-dihydro-1H-benzo(e)(1,4)diazepine-4(5H)-carboxylate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
Tert-butyl 8-chloro-1,2,3,5-tetrahydro-1,4-benzodiazepine-4-carboxylate (CAS 886364-27-8) is a chemical compound with the molecular formula C14H19ClN2O2 and a molecular weight of 282.76 g/mol. IUPAC name: tert-butyl 8-chloro-1,2,3,5-tetrahydro-1,4-benzodiazepine-4-carboxylate. InChIKey: BRVJAQILUHAISO-UHFFFAOYSA-N.
| Molecular formula | C14H19ClN2O2 |
|---|---|
| Molecular weight | 282.76 g/mol |
| IUPAC name | tert-butyl 8-chloro-1,2,3,5-tetrahydro-1,4-benzodiazepine-4-carboxylate |
| InChIKey | BRVJAQILUHAISO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNC2=C(C1)C=CC(=C2)Cl |
Computed by PubChem (NCBI)