CAS 1329171-69-8 is the registry number for Carbamic acid, n-[(1s)-1-(4-chloro-2-pyridinyl)-3-buten-1-yl]-, 1,1-dimethylethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl N-[(1S)-1-(4-chloro-2-pyridinyl)but-3-enyl]carbamate (CAS 1329171-69-8) is a chemical compound with the molecular formula C14H19ClN2O2 and a molecular weight of 282.76 g/mol. IUPAC name: tert-butyl N-[(1S)-1-(4-chloro-2-pyridinyl)but-3-enyl]carbamate. InChIKey: TYTXYIDIHBTPHK-NSHDSACASA-N.
| Molecular formula | C14H19ClN2O2 |
|---|---|
| Molecular weight | 282.76 g/mol |
| IUPAC name | tert-butyl N-[(1S)-1-(4-chloro-2-pyridinyl)but-3-enyl]carbamate |
| InChIKey | TYTXYIDIHBTPHK-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC=C)C1=NC=CC(=C1)Cl |
Computed by PubChem (NCBI)