Products 1098535-19-3
CAS 1098535-19-3 is the registry number for (S)-2-(Adamantan-2-yl)-2-((tert-butoxycarbonyl)amino)acetic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(2-adamantyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 1098535-19-3) is a chemical compound with the molecular formula C17H27NO4 and a molecular weight of 309.4 g/mol. IUPAC name: (2S)-2-(2-adamantyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: AJNHBFRONRUAIK-IXKAHESDSA-N.
| Molecular formula | C17H27NO4 |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | (2S)-2-(2-adamantyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | AJNHBFRONRUAIK-IXKAHESDSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C1C2CC3CC(C2)CC1C3)C(=O)O |
Computed by PubChem (NCBI)