CAS 120303-51-7 is the registry number for N-((-)-Jasmonoyl)-(L)-valine. Offered by: TRC. Available pack sizes: 25mg.
(2S)-3-methyl-2-[[2-[(1S,2S)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]amino]butanoic acid (CAS 120303-51-7) is a chemical compound with the molecular formula C17H27NO4 and a molecular weight of 309.4 g/mol. IUPAC name: (2S)-3-methyl-2-[[2-[(1S,2S)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]amino]butanoic acid. InChIKey: LZPFFKBGBPBJAW-OLTVGNICSA-N.
| Molecular formula | C17H27NO4 |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | (2S)-3-methyl-2-[[2-[(1S,2S)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]amino]butanoic acid |
| InChIKey | LZPFFKBGBPBJAW-OLTVGNICSA-N |
| SMILES | CC/C=C\C[C@H]1[C@@H](CCC1=O)CC(=O)N[C@@H](C(C)C)C(=O)O |
Computed by PubChem (NCBI)