CAS 528894-70-4 appears in our catalog under these names: 4-(3,3-Dimethylbutan-2-yl) 2-propyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate, 98%, O4-(3,3-dimethylbutan-2-yl) O2-propyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 100mg, 50mg, 10mg, 25mg.
4-O-(3,3-dimethylbutan-2-yl) 2-O-propyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate (CAS 528894-70-4) is a chemical compound with the molecular formula C17H27NO4 and a molecular weight of 309.4 g/mol. IUPAC name: 4-O-(3,3-dimethylbutan-2-yl) 2-O-propyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate. InChIKey: DOYZAIRDDZPMQZ-UHFFFAOYSA-N.
| Molecular formula | C17H27NO4 |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | 4-O-(3,3-dimethylbutan-2-yl) 2-O-propyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate |
| InChIKey | DOYZAIRDDZPMQZ-UHFFFAOYSA-N |
| SMILES | CCCOC(=O)C1=C(C(=C(N1)C)C(=O)OC(C)C(C)(C)C)C |
Computed by PubChem (NCBI)