Products 1099046-07-7

CAS 1099046-07-7 is the registry number for 4-(4-tert-Butyl-2-methylphenoxy)butanoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

4-(4-tert-butyl-2-methylphenoxy)butanoic acid (CAS 1099046-07-7) is a chemical compound with the molecular formula C15H22O3 and a molecular weight of 250.33 g/mol. IUPAC name: 4-(4-tert-butyl-2-methylphenoxy)butanoic acid. InChIKey: DBENJXOKYASJSU-UHFFFAOYSA-N.

Identity
Molecular formulaC15H22O3
Molecular weight250.33 g/mol
IUPAC name4-(4-tert-butyl-2-methylphenoxy)butanoic acid
InChIKeyDBENJXOKYASJSU-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=C1)C(C)(C)C)OCCCC(=O)O

Computed by PubChem (NCBI)