Products 1099597-50-8
CAS 1099597-50-8 is the registry number for 4-Chloro-2-(2,2,2-trifluoroethyl)-1-(trifluoromethyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
4-chloro-2-(2,2,2-trifluoroethyl)-1-(trifluoromethyl)benzene (CAS 1099597-50-8) is a chemical compound with the molecular formula C9H5ClF6 and a molecular weight of 262.58 g/mol. IUPAC name: 4-chloro-2-(2,2,2-trifluoroethyl)-1-(trifluoromethyl)benzene. InChIKey: DRVUHZIGJRWBOG-UHFFFAOYSA-N.
| Molecular formula | C9H5ClF6 |
|---|---|
| Molecular weight | 262.58 g/mol |
| IUPAC name | 4-chloro-2-(2,2,2-trifluoroethyl)-1-(trifluoromethyl)benzene |
| InChIKey | DRVUHZIGJRWBOG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)CC(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)