CAS 195136-46-0 appears in our catalog under these names: 2,4-Bis(trifluoromethyl)benzyl chloride, 95%, 1-(Chloromethyl)-2,4-bis(trifluoromethyl)benzene, 95+%, 2,4-Bis(trifluoromethyl)benzyl chloride. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 25g, 1g, 5g.
1-(chloromethyl)-2,4-bis(trifluoromethyl)benzene (CAS 195136-46-0) is a chemical compound with the molecular formula C9H5ClF6 and a molecular weight of 262.58 g/mol. IUPAC name: 1-(chloromethyl)-2,4-bis(trifluoromethyl)benzene. InChIKey: DPKQSESRNWBUFZ-UHFFFAOYSA-N.
| Molecular formula | C9H5ClF6 |
|---|---|
| Molecular weight | 262.58 g/mol |
| IUPAC name | 1-(chloromethyl)-2,4-bis(trifluoromethyl)benzene |
| InChIKey | DPKQSESRNWBUFZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C(F)(F)F)CCl |
Computed by PubChem (NCBI)