Products 911060-71-4

CAS 911060-71-4 is the registry number for 2,5-Bis(trifluoromethyl)benzyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg, 1g.

Structural formula: {0} (CAS {1})

2-(chloromethyl)-1,4-bis(trifluoromethyl)benzene (CAS 911060-71-4) is a chemical compound with the molecular formula C9H5ClF6 and a molecular weight of 262.58 g/mol. IUPAC name: 2-(chloromethyl)-1,4-bis(trifluoromethyl)benzene. InChIKey: NFRNXRHGNOIVOT-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5ClF6
Molecular weight262.58 g/mol
IUPAC name2-(chloromethyl)-1,4-bis(trifluoromethyl)benzene
InChIKeyNFRNXRHGNOIVOT-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(F)(F)F)CCl)C(F)(F)F

Computed by PubChem (NCBI)