CAS 911060-71-4 is the registry number for 2,5-Bis(trifluoromethyl)benzyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg, 1g.
2-(chloromethyl)-1,4-bis(trifluoromethyl)benzene (CAS 911060-71-4) is a chemical compound with the molecular formula C9H5ClF6 and a molecular weight of 262.58 g/mol. IUPAC name: 2-(chloromethyl)-1,4-bis(trifluoromethyl)benzene. InChIKey: NFRNXRHGNOIVOT-UHFFFAOYSA-N.
| Molecular formula | C9H5ClF6 |
|---|---|
| Molecular weight | 262.58 g/mol |
| IUPAC name | 2-(chloromethyl)-1,4-bis(trifluoromethyl)benzene |
| InChIKey | NFRNXRHGNOIVOT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)CCl)C(F)(F)F |
Computed by PubChem (NCBI)