CAS 75462-59-8 appears in our catalog under these names: 3,5-Bis(trifluoromethyl)benzyl chloride, 97%, 3,5–Bis(trifluoromethyl)benzyl chloride, 3,5-Bis(trifluoromethyl)benzyl Chloride, >97.0%(GC), 1-(Chloromethyl)-3,5-bis(trifluoromethyl)benzene 98%, 3,5-Bis(trifluoromethyl)benzyl chloride. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Fluorochem. Available pack sizes: 500g, 100g, 25g, 5g, 1g.
1-(chloromethyl)-3,5-bis(trifluoromethyl)benzene (CAS 75462-59-8) is a chemical compound with the molecular formula C9H5ClF6 and a molecular weight of 262.58 g/mol. IUPAC name: 1-(chloromethyl)-3,5-bis(trifluoromethyl)benzene. InChIKey: OINTXXMBRBLMHH-UHFFFAOYSA-N.
| Molecular formula | C9H5ClF6 |
|---|---|
| Molecular weight | 262.58 g/mol |
| IUPAC name | 1-(chloromethyl)-3,5-bis(trifluoromethyl)benzene |
| InChIKey | OINTXXMBRBLMHH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)C(F)(F)F)CCl |
Computed by PubChem (NCBI)