CAS 1099597-92-8 is the registry number for 3,6-Difluoro-2-(trifluoromethyl)pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
3,6-difluoro-2-(trifluoromethyl)pyridine (CAS 1099597-92-8) is a chemical compound with the molecular formula C6H2F5N and a molecular weight of 183.08 g/mol. IUPAC name: 3,6-difluoro-2-(trifluoromethyl)pyridine. InChIKey: GOFPGPTXLNVIQI-UHFFFAOYSA-N.
| Molecular formula | C6H2F5N |
|---|---|
| Molecular weight | 183.08 g/mol |
| IUPAC name | 3,6-difluoro-2-(trifluoromethyl)pyridine |
| InChIKey | GOFPGPTXLNVIQI-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1F)C(F)(F)F)F |
Computed by PubChem (NCBI)