CAS 1099598-21-6 appears in our catalog under these names: 3,5-Difluoro-2-(trifluoromethyl)pyridine, 95%, 3,5-Difluoro-2-(trifluoromethyl)pyridine, 97%, 3,5-Difluoro-2-(trifluoromethyl)pyridine. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg.
3,5-difluoro-2-(trifluoromethyl)pyridine (CAS 1099598-21-6) is a chemical compound with the molecular formula C6H2F5N and a molecular weight of 183.08 g/mol. IUPAC name: 3,5-difluoro-2-(trifluoromethyl)pyridine. InChIKey: XQFDPSQBADRNCO-UHFFFAOYSA-N.
| Molecular formula | C6H2F5N |
|---|---|
| Molecular weight | 183.08 g/mol |
| IUPAC name | 3,5-difluoro-2-(trifluoromethyl)pyridine |
| InChIKey | XQFDPSQBADRNCO-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1F)C(F)(F)F)F |
Computed by PubChem (NCBI)