Products 58584-98-8
CAS 58584-98-8 appears in our catalog under these names: 2,6-Difluoro-3-trifluoromethylpyridine, 98+%, 2,6-Difluoro-3-(trifluoromethyl)pyridine, 97%, 2,6-Difluoro-3-trifluoromethylpyridine. Offered by: AmBeed, Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
2,6-difluoro-3-(trifluoromethyl)pyridine (CAS 58584-98-8) is a chemical compound with the molecular formula C6H2F5N and a molecular weight of 183.08 g/mol. IUPAC name: 2,6-difluoro-3-(trifluoromethyl)pyridine. InChIKey: XQOSKGHWFHZLCZ-UHFFFAOYSA-N.
| Molecular formula | C6H2F5N |
|---|---|
| Molecular weight | 183.08 g/mol |
| IUPAC name | 2,6-difluoro-3-(trifluoromethyl)pyridine |
| InChIKey | XQOSKGHWFHZLCZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C(F)(F)F)F)F |
Computed by PubChem (NCBI)