CAS 1099687-04-3 appears in our catalog under these names: 4-Bromo-2-(4-methylpiperazin-1-yl)benzoic acid, 97%, 4-Bromo-2-(4-methylpiperazin-1-yl)benzoic acid, 98%, 4–Bromo–2–(4–methyl–1–piperazinyl)benzoic Acid, 4-Bromo-2-(4-methyl-1-piperazinyl)benzoic Acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 250mg, 25g, 100mg.
4-bromo-2-(4-methylpiperazin-1-yl)benzoic acid (CAS 1099687-04-3) is a chemical compound with the molecular formula C12H15BrN2O2 and a molecular weight of 299.16 g/mol. IUPAC name: 4-bromo-2-(4-methylpiperazin-1-yl)benzoic acid. InChIKey: YVLKSWSBJTWPLY-UHFFFAOYSA-N.
| Molecular formula | C12H15BrN2O2 |
|---|---|
| Molecular weight | 299.16 g/mol |
| IUPAC name | 4-bromo-2-(4-methylpiperazin-1-yl)benzoic acid |
| InChIKey | YVLKSWSBJTWPLY-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=C(C=CC(=C2)Br)C(=O)O |
Computed by PubChem (NCBI)