CAS 2138224-35-6 is the registry number for 1-(2-Bromo-5-nitro-benzyl)-piperidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-[(2-bromo-5-nitrophenyl)methyl]piperidine (CAS 2138224-35-6) is a chemical compound with the molecular formula C12H15BrN2O2 and a molecular weight of 299.16 g/mol. IUPAC name: 1-[(2-bromo-5-nitrophenyl)methyl]piperidine. InChIKey: HUHCHFCSJXSJQX-UHFFFAOYSA-N.
| Molecular formula | C12H15BrN2O2 |
|---|---|
| Molecular weight | 299.16 g/mol |
| IUPAC name | 1-[(2-bromo-5-nitrophenyl)methyl]piperidine |
| InChIKey | HUHCHFCSJXSJQX-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)CC2=C(C=CC(=C2)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)