CAS 1864072-50-3 is the registry number for 4-Bromo-N,N'-diethylphthalamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 10g, 100g, 5g.
4-bromo-1-N,2-N-diethylbenzene-1,2-dicarboxamide (CAS 1864072-50-3) is a chemical compound with the molecular formula C12H15BrN2O2 and a molecular weight of 299.16 g/mol. IUPAC name: 4-bromo-1-N,2-N-diethylbenzene-1,2-dicarboxamide. InChIKey: SUWXOUBWWBBNRJ-UHFFFAOYSA-N.
| Molecular formula | C12H15BrN2O2 |
|---|---|
| Molecular weight | 299.16 g/mol |
| IUPAC name | 4-bromo-1-N,2-N-diethylbenzene-1,2-dicarboxamide |
| InChIKey | SUWXOUBWWBBNRJ-UHFFFAOYSA-N |
| SMILES | CCNC(=O)C1=C(C=C(C=C1)Br)C(=O)NCC |
Computed by PubChem (NCBI)