Products 1864072-50-3

CAS 1864072-50-3 is the registry number for 4-Bromo-N,N'-diethylphthalamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 10g, 100g, 5g.

Structural formula: {0} (CAS {1})

4-bromo-1-N,2-N-diethylbenzene-1,2-dicarboxamide (CAS 1864072-50-3) is a chemical compound with the molecular formula C12H15BrN2O2 and a molecular weight of 299.16 g/mol. IUPAC name: 4-bromo-1-N,2-N-diethylbenzene-1,2-dicarboxamide. InChIKey: SUWXOUBWWBBNRJ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15BrN2O2
Molecular weight299.16 g/mol
IUPAC name4-bromo-1-N,2-N-diethylbenzene-1,2-dicarboxamide
InChIKeySUWXOUBWWBBNRJ-UHFFFAOYSA-N
SMILESCCNC(=O)C1=C(C=C(C=C1)Br)C(=O)NCC

Computed by PubChem (NCBI)