CAS 109971-63-3 appears in our catalog under these names: Combretastatin A-1, 95+%, Combretastatin A-1/ 97.49% (existing batch purity), Combretastatin A1, Combretastatin A1, (Z)-3-Methoxy-6-(3,4,5-trimethoxystyryl)benzene-1,2-diol, 97.49% ,, 97.49% ,. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 1mg, 10mg, 25mg, 5mg, 50mg, 5 mg, 25 mg.
3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]benzene-1,2-diol (CAS 109971-63-3) is a chemical compound with the molecular formula C18H20O6 and a molecular weight of 332.3 g/mol. IUPAC name: 3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]benzene-1,2-diol. InChIKey: YUSYSJSHVJULID-WAYWQWQTSA-N.
| Molecular formula | C18H20O6 |
|---|---|
| Molecular weight | 332.3 g/mol |
| IUPAC name | 3-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]benzene-1,2-diol |
| InChIKey | YUSYSJSHVJULID-WAYWQWQTSA-N |
| SMILES | COC1=C(C(=C(C=C1)/C=C\C2=CC(=C(C(=C2)OC)OC)OC)O)O |
Computed by PubChem (NCBI)