Products 70103-21-8

CAS 70103-21-8 is the registry number for Dimethyl 1,4-diethoxynaphthalene-2,3-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Dimethyl 1,4-diethoxynaphthalene-2,3-dicarboxylate (CAS 70103-21-8) is a chemical compound with the molecular formula C18H20O6 and a molecular weight of 332.3 g/mol. IUPAC name: dimethyl 1,4-diethoxynaphthalene-2,3-dicarboxylate. InChIKey: IGSVXBZCJUMFJV-UHFFFAOYSA-N.

Identity
Molecular formulaC18H20O6
Molecular weight332.3 g/mol
IUPAC namedimethyl 1,4-diethoxynaphthalene-2,3-dicarboxylate
InChIKeyIGSVXBZCJUMFJV-UHFFFAOYSA-N
SMILESCCOC1=C(C(=C(C2=CC=CC=C21)OCC)C(=O)OC)C(=O)OC

Computed by PubChem (NCBI)