CAS 39595-41-0 is the registry number for Heveadride. Offered by: MedChemExpress. Available pack sizes: Get quote.
(9S,10R)-10-ethyl-9-propyl-6,14-dioxatricyclo[10.3.0.04,8]pentadeca-1(12),4(8)-diene-5,7,13,15-tetrone (CAS 39595-41-0) is a chemical compound with the molecular formula C18H20O6 and a molecular weight of 332.3 g/mol. IUPAC name: (9S,10R)-10-ethyl-9-propyl-6,14-dioxatricyclo[10.3.0.04,8]pentadeca-1(12),4(8)-diene-5,7,13,15-tetrone. InChIKey: OJIGDJPKCFGFKH-ZJUUUORDSA-N.
| Molecular formula | C18H20O6 |
|---|---|
| Molecular weight | 332.3 g/mol |
| IUPAC name | (9S,10R)-10-ethyl-9-propyl-6,14-dioxatricyclo[10.3.0.04,8]pentadeca-1(12),4(8)-diene-5,7,13,15-tetrone |
| InChIKey | OJIGDJPKCFGFKH-ZJUUUORDSA-N |
| SMILES | CCC[C@H]1[C@@H](CC2=C(CCC3=C1C(=O)OC3=O)C(=O)OC2=O)CC |
Computed by PubChem (NCBI)