Products 1100-23-8
CAS 1100-23-8 appears in our catalog under these names: Dansyl-L-asparagine, >95% (HPLC), (2S)-3-Carbamoyl-2-(5-(dimethylamino)naphthalene-1-sulfonamido)propanoic acid. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 250mg, 50mg, 0,5g.
(2S)-4-amino-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-4-oxobutanoic acid (CAS 1100-23-8) is a chemical compound with the molecular formula C16H19N3O5S and a molecular weight of 365.4 g/mol. IUPAC name: (2S)-4-amino-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-4-oxobutanoic acid. InChIKey: LRBOEWHGZIFPKV-LBPRGKRZSA-N.
| Molecular formula | C16H19N3O5S |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | (2S)-4-amino-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-4-oxobutanoic acid |
| InChIKey | LRBOEWHGZIFPKV-LBPRGKRZSA-N |
| SMILES | CN(C)C1=CC=CC2=C1C=CC=C2S(=O)(=O)N[C@@H](CC(=O)N)C(=O)O |
Computed by PubChem (NCBI)