CAS 33755-53-2 appears in our catalog under these names: (+)-Biotin-ONP, (+)-Biotin-ONP/ 99.91% (existing batch purity), (+)–Biotin–ONP, D-Biotin p-nitrophenyl ester, (+)-Biotin 4-Nitrophenyl Ester, >98.0%(HPLC)(N). Offered by: TRC, TargetMol, GLPBio, Chemat, TCI. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 500mg, 200mg, 1g, 5g.
(4-nitrophenyl) 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate (CAS 33755-53-2) is a chemical compound with the molecular formula C16H19N3O5S and a molecular weight of 365.4 g/mol. IUPAC name: (4-nitrophenyl) 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate. InChIKey: YUDNXDTXQPYKCA-YDHLFZDLSA-N.
| Molecular formula | C16H19N3O5S |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | (4-nitrophenyl) 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
| InChIKey | YUDNXDTXQPYKCA-YDHLFZDLSA-N |
| SMILES | C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)OC3=CC=C(C=C3)[N+](=O)[O-])NC(=O)N2 |
Computed by PubChem (NCBI)