Products 131303-71-4
CAS 131303-71-4 is the registry number for D-(+)Biotin 2-Nitrophenyl Ester. Offered by: TRC. Available pack sizes: 2,5g.
(2-nitrophenyl) 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate (CAS 131303-71-4) is a chemical compound with the molecular formula C16H19N3O5S and a molecular weight of 365.4 g/mol. IUPAC name: (2-nitrophenyl) 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate. InChIKey: ALDYXYRBHNYQRB-XEGUGMAKSA-N.
| Molecular formula | C16H19N3O5S |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | (2-nitrophenyl) 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
| InChIKey | ALDYXYRBHNYQRB-XEGUGMAKSA-N |
| SMILES | C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)OC3=CC=CC=C3[N+](=O)[O-])NC(=O)N2 |
Computed by PubChem (NCBI)