Products 1101167-61-6
CAS 1101167-61-6 is the registry number for 2-(3,5-Dimethyl-4-isoxazolyl)pyridine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, 50g.
3,5-dimethyl-4-pyridin-2-yl-1,2-oxazole (CAS 1101167-61-6) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. IUPAC name: 3,5-dimethyl-4-pyridin-2-yl-1,2-oxazole. InChIKey: KGDISOQTTNBZEL-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 3,5-dimethyl-4-pyridin-2-yl-1,2-oxazole |
| InChIKey | KGDISOQTTNBZEL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)C2=CC=CC=N2 |
Computed by PubChem (NCBI)