CAS 1101906-42-6 appears in our catalog under these names: 4,4-Dimethyl-2-(1,10-phenanthrolin-2-yl)-4,5-dihydrooxazole 98%, 4,4-Dimethyl-2-(1,10-phenanthrolin-2-yl)-4,5-dihydrooxazole, 98%, 98%, 4,4-Dimethyl-2-(1,10-phenanthrolin-2-yl)-4,5-dihydrooxazole, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
4,4-dimethyl-2-(1,10-phenanthrolin-2-yl)-5H-1,3-oxazole (CAS 1101906-42-6) is a chemical compound with the molecular formula C17H15N3O and a molecular weight of 277.32 g/mol. IUPAC name: 4,4-dimethyl-2-(1,10-phenanthrolin-2-yl)-5H-1,3-oxazole. InChIKey: HLTAMVODSLPKSD-UHFFFAOYSA-N.
| Molecular formula | C17H15N3O |
|---|---|
| Molecular weight | 277.32 g/mol |
| IUPAC name | 4,4-dimethyl-2-(1,10-phenanthrolin-2-yl)-5H-1,3-oxazole |
| InChIKey | HLTAMVODSLPKSD-UHFFFAOYSA-N |
| SMILES | CC1(COC(=N1)C2=NC3=C(C=CC4=C3N=CC=C4)C=C2)C |
Computed by PubChem (NCBI)