CAS 59661-47-1 is the registry number for 1-(4-Methoxyphenyl)-4,6-dimethyl-1H-pyrrolo(2,3-b)pyridine-3-carbonitrile, 95%. Offered by: AmBeed. Available pack sizes: 100mg.
1-(4-methoxyphenyl)-4,6-dimethylpyrrolo[2,3-b]pyridine-3-carbonitrile (CAS 59661-47-1) is a chemical compound with the molecular formula C17H15N3O and a molecular weight of 277.32 g/mol. IUPAC name: 1-(4-methoxyphenyl)-4,6-dimethylpyrrolo[2,3-b]pyridine-3-carbonitrile. InChIKey: WGFNBQKYVGVQGF-UHFFFAOYSA-N.
| Molecular formula | C17H15N3O |
|---|---|
| Molecular weight | 277.32 g/mol |
| IUPAC name | 1-(4-methoxyphenyl)-4,6-dimethylpyrrolo[2,3-b]pyridine-3-carbonitrile |
| InChIKey | WGFNBQKYVGVQGF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1C(=CN2C3=CC=C(C=C3)OC)C#N)C |
Computed by PubChem (NCBI)