Products 312510-18-2
CAS 312510-18-2 is the registry number for 2,7-Diamino-4-(p-tolyl)-4H-chromene-3-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,7-diamino-4-(4-methylphenyl)-4H-chromene-3-carbonitrile (CAS 312510-18-2) is a chemical compound with the molecular formula C17H15N3O and a molecular weight of 277.32 g/mol. IUPAC name: 2,7-diamino-4-(4-methylphenyl)-4H-chromene-3-carbonitrile. InChIKey: WCZDODNEUXVJGQ-UHFFFAOYSA-N.
| Molecular formula | C17H15N3O |
|---|---|
| Molecular weight | 277.32 g/mol |
| IUPAC name | 2,7-diamino-4-(4-methylphenyl)-4H-chromene-3-carbonitrile |
| InChIKey | WCZDODNEUXVJGQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2C3=C(C=C(C=C3)N)OC(=C2C#N)N |
Computed by PubChem (NCBI)