CAS 1102895-84-0 is the registry number for (2S)-2-((Furan-3-yl)formamido)-3-(4-hydroxyphenyl)propanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2S)-2-(furan-3-carbonylamino)-3-(4-hydroxyphenyl)propanoic acid (CAS 1102895-84-0) is a chemical compound with the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. IUPAC name: (2S)-2-(furan-3-carbonylamino)-3-(4-hydroxyphenyl)propanoic acid. InChIKey: IZVSLAYMDNDPBA-LBPRGKRZSA-N.
| Molecular formula | C14H13NO5 |
|---|---|
| Molecular weight | 275.26 g/mol |
| IUPAC name | (2S)-2-(furan-3-carbonylamino)-3-(4-hydroxyphenyl)propanoic acid |
| InChIKey | IZVSLAYMDNDPBA-LBPRGKRZSA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](C(=O)O)NC(=O)C2=COC=C2)O |
Computed by PubChem (NCBI)