Products 110299-23-5
CAS 110299-23-5 is the registry number for 1,6-Pyrenedicarboxylic acid, ≥95%. Offered by: Chemat. Available pack sizes: 50mg, 250mg.
Pyrene-1,6-dicarboxylic acid (CAS 110299-23-5) is a chemical compound with the molecular formula C18H10O4 and a molecular weight of 290.3 g/mol. IUPAC name: pyrene-1,6-dicarboxylic acid. InChIKey: IJDIPICFINEEDN-UHFFFAOYSA-N.
| Molecular formula | C18H10O4 |
|---|---|
| Molecular weight | 290.3 g/mol |
| IUPAC name | pyrene-1,6-dicarboxylic acid |
| InChIKey | IJDIPICFINEEDN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC3=C2C4=C1C=CC(=C4C=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)