CAS 116075-75-3 appears in our catalog under these names: 4,4'–(Buta–1,3–diyne–1,4–diyl)dibenzoicacid, 4,4'-(Buta-1,3-diyne-1,4-diyl)dibenzoic acid 98%, 4,4'-(Buta-1,3-diyne-1,4-diyl)dibenzoic acid, 98%, 98%, 4,4'-(Buta-1,3-diyne-1,4-diyl)dibenzoic acid, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
4-[4-(4-carboxyphenyl)buta-1,3-diynyl]benzoic acid (CAS 116075-75-3) is a chemical compound with the molecular formula C18H10O4 and a molecular weight of 290.3 g/mol. IUPAC name: 4-[4-(4-carboxyphenyl)buta-1,3-diynyl]benzoic acid. InChIKey: YROTZTMCXKTYMW-UHFFFAOYSA-N.
| Molecular formula | C18H10O4 |
|---|---|
| Molecular weight | 290.3 g/mol |
| IUPAC name | 4-[4-(4-carboxyphenyl)buta-1,3-diynyl]benzoic acid |
| InChIKey | YROTZTMCXKTYMW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#CC#CC2=CC=C(C=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)